C26H31F6N2O4S2+ — CID 159423091
2,3-bis(trifluoromethylsulfonyl)fluoren-1-imine;1-methyl-1-pentylpiperidin-1-ium (PubChem CID 159423091) has the molecular formula C26H31F6N2O4S2+ and a molecular weight of 613.67 g/mol. Its IUPAC name is 2,3-bis(trifluoromethylsulfonyl)fluoren-1-imine;1-methyl-1-pentylpiperidin-1-ium.
| Compound Name | 2,3-bis(trifluoromethylsulfonyl)fluoren-1-imine;1-methyl-1-pentylpiperidin-1-ium |
|---|---|
| PubChem CID | 159423091 |
| Molecular Formula | C26H31F6N2O4S2+ |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | 2,3-bis(trifluoromethylsulfonyl)fluoren-1-imine;1-methyl-1-pentylpiperidin-1-ium |
| SMILES | CCCCC[N+]1(C)CCCCC1.[H]/N=C1\C2=Cc3ccccc3C2=CC(S(=O)(=O)C(F)(F)F)=C1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H7F6NO4S2.C11H24N/c16-14(17,18)27(23,24)11-6-9-8-4-2-1-3-7(8)5-10(9)12(22)13(11)28(25,26)15(19,20)21;1-3-4-6-9-12(2)10-7-5-8-11-12/h1-6,22H;3-11H2,1-2H3/q;+1/b22-12+; |
| InChIKey | LPZWKIDBDOUMGY-RSRKELGKSA-N |
| XLogP | 6.39 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|