C22H23NO4 — CID 161480372
hept-2-ene;1-iminofluorene-2,3-dicarboxylic acid (PubChem CID 161480372) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is hept-2-ene;1-iminofluorene-2,3-dicarboxylic acid.
| Compound Name | hept-2-ene;1-iminofluorene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 161480372 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | hept-2-ene;1-iminofluorene-2,3-dicarboxylic acid |
| SMILES | CC=CCCCC.[H]/N=C1\C2=Cc3ccccc3C2=CC(C(=O)O)=C1C(=O)O |
| InChI | InChI=1S/C15H9NO4.C7H14/c16-13-10-5-7-3-1-2-4-8(7)9(10)6-11(14(17)18)12(13)15(19)20;1-3-5-7-6-4-2/h1-6,16H,(H,17,18)(H,19,20);3,5H,4,6-7H2,1-2H3/b16-13+; |
| InChIKey | WEGVSHYWGAJUSB-ZUQRMPMESA-N |
| XLogP | 4.72 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|