C26H27F10N2O4S2+ — CID 159241496
2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyl)fluoren-1-imine;1-butyl-1-methylpyrrolidin-1-ium (PubChem CID 159241496) has the molecular formula C26H27F10N2O4S2+ and a molecular weight of 685.63 g/mol. Its IUPAC name is 2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyl)fluoren-1-imine;1-butyl-1-methylpyrrolidin-1-ium.
| Compound Name | 2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyl)fluoren-1-imine;1-butyl-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 159241496 |
| Molecular Formula | C26H27F10N2O4S2+ |
| Molecular Weight | 685.63 g/mol |
| Exact Mass | 685.12 |
| IUPAC Name | 2,3-bis(1,1,2,2,2-pentafluoroethylsulfonyl)fluoren-1-imine;1-butyl-1-methylpyrrolidin-1-ium |
| SMILES | CCCC[N+]1(C)CCCC1.[H]/N=C1\C2=Cc3ccccc3C2=CC(S(=O)(=O)C(F)(F)C(F)(F)F)=C1S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H7F10NO4S2.C9H20N/c18-14(19,20)16(24,25)33(29,30)11-6-9-8-4-2-1-3-7(8)5-10(9)12(28)13(11)34(31,32)17(26,27)15(21,22)23;1-3-4-7-10(2)8-5-6-9-10/h1-6,28H;3-9H2,1-2H3/q;+1/b28-12+; |
| InChIKey | KUDRCLHRLOGMSV-ZAJJSZMNSA-N |
| XLogP | 6.88 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.63 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|