C35H50N6O8 — CID 159431089
ethyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate;ethyl 2-[2-(benzylcarbamoyl)-2-prop-2-enylhydrazinyl]acetate (PubChem CID 159431089) has the molecular formula C35H50N6O8 and a molecular weight of 682.82 g/mol. Its IUPAC name is ethyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate;ethyl 2-[2-(benzylcarbamoyl)-2-prop-2-enylhydrazinyl]acetate.
| Compound Name | ethyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate;ethyl 2-[2-(benzylcarbamoyl)-2-prop-2-enylhydrazinyl]acetate |
|---|---|
| PubChem CID | 159431089 |
| Molecular Formula | C35H50N6O8 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.37 |
| IUPAC Name | ethyl 2-[[benzylcarbamoyl(prop-2-enyl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate;ethyl 2-[2-(benzylcarbamoyl)-2-prop-2-enylhydrazinyl]acetate |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N(CC(=O)OCC)C(=O)OC(C)(C)C.C=CCN(NCC(=O)OCC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O5.C15H21N3O3/c1-6-13-22(18(25)21-14-16-11-9-8-10-12-16)23(15-17(24)27-7-2)19(26)28-20(3,4)5;1-3-10-18(17-12-14(19)21-4-2)15(20)16-11-13-8-6-5-7-9-13/h6,8-12H,1,7,13-15H2,2-5H3,(H,21,25);3,5-9,17H,1,4,10-12H2,2H3,(H,16,20) |
| InChIKey | LQZNPRUPDMCSCS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 158.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|