About 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one
3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one (PubChem CID 15944646) has the molecular formula C23H15Cl2N3O
and a molecular weight of 420.30 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one.
Molecular Properties
| Compound Name | 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one |
| PubChem CID | 15944646 |
| Molecular Formula | C23H15Cl2N3O |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one |
| SMILES | O=c1c(-c2nc3ccccc3[nH]2)c(Cl)c2cc(Cl)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H15Cl2N3O/c24-15-10-11-19-16(12-15)21(25)20(22-26-17-8-4-5-9-18(17)27-22)23(29)28(19)13-14-6-2-1-3-7-14/h1-12H,13H2,(H,26,27) |
| InChIKey | SYGOKQXPKMWHLK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one?
The IUPAC name of 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one (CID 15944646) is 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one.
What is the SMILES notation for 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one?
The canonical SMILES for 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one is O=c1c(-c2nc3ccccc3[nH]2)c(Cl)c2cc(Cl)ccc2n1Cc1ccccc1.
What is the InChIKey of 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one?
The InChIKey is SYGOKQXPKMWHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15Cl2N3O/c24-15-10-11-19-16(12-15)21(25)20(22-26-17-8-4-5-9-18(17)27-22)23(29)28(19)13-14-6-2-1-3-7-14/h1-12H,13H2,(H,26,27).
What are the key properties of 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one?
3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one has a molecular weight of 420.30 g/mol, XLogP of 5.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-benzimidazol-2-yl)-1-benzyl-4,6-dichloroquinolin-2-one is sourced from PubChem (CID 15944646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).