C18H26N4O2 — CID 159447229
1,4-dioxane;6-N-piperidin-3-ylisoquinoline-1,6-diamine (PubChem CID 159447229) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1,4-dioxane;6-N-piperidin-3-ylisoquinoline-1,6-diamine.
| Compound Name | 1,4-dioxane;6-N-piperidin-3-ylisoquinoline-1,6-diamine |
|---|---|
| PubChem CID | 159447229 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1,4-dioxane;6-N-piperidin-3-ylisoquinoline-1,6-diamine |
| SMILES | C1COCCO1.Nc1nccc2cc(NC3CCCNC3)ccc12 |
| InChI | InChI=1S/C14H18N4.C4H8O2/c15-14-13-4-3-11(8-10(13)5-7-17-14)18-12-2-1-6-16-9-12;1-2-6-4-3-5-1/h3-5,7-8,12,16,18H,1-2,6,9H2,(H2,15,17);1-4H2 |
| InChIKey | LSXGPDWPWFRXAE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |