C33H41N9O5Si — CID 159450143
1,6-dimethyl-3-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione;3,8-dimethyl-1-(pyridin-2-ylmethyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 159450143) has the molecular formula C33H41N9O5Si and a molecular weight of 671.84 g/mol. Its IUPAC name is 1,6-dimethyl-3-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione;3,8-dimethyl-1-(pyridin-2-ylmethyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 1,6-dimethyl-3-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione;3,8-dimethyl-1-(pyridin-2-ylmethyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 159450143 |
| Molecular Formula | C33H41N9O5Si |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | 1,6-dimethyl-3-(pyridin-2-ylmethyl)-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione;3,8-dimethyl-1-(pyridin-2-ylmethyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | CC1=Nc2c(c(=O)n(Cc3ccccn3)c(=O)n2C)C1.Cc1nc2c(c(=O)n(Cc3ccccn3)c(=O)n2C)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H27N5O3Si.C14H14N4O2/c1-14-21-17-16(24(14)13-27-10-11-28(3,4)5)18(25)23(19(26)22(17)2)12-15-8-6-7-9-20-15;1-9-7-11-12(16-9)17(2)14(20)18(13(11)19)8-10-5-3-4-6-15-10/h6-9H,10-13H2,1-5H3;3-6H,7-8H2,1-2H3 |
| InChIKey | LTGPTJSLHAULCB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 153.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|