C18H14ClF3N6O2S — CID 15945292
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 15945292) has the molecular formula C18H14ClF3N6O2S and a molecular weight of 470.86 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 15945292 |
| Molecular Formula | C18H14ClF3N6O2S |
| Molecular Weight | 470.86 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | CC(Sc1nnnn1-c1ccc(Cl)cc1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H14ClF3N6O2S/c1-9(31-18-25-26-27-28(18)11-4-2-10(19)3-5-11)17(30)23-8-14(29)24-13-7-6-12(20)15(21)16(13)22/h2-7,9H,8H2,1H3,(H,23,30)(H,24,29) |
| InChIKey | IKPPQLDVGJTNCX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|