C30H35NO8 — CID 159455381
acetic acid;2,2-diethyl-6-isocyano-3H-chromen-4-one;(2,2-diethyl-4-oxo-3H-chromen-6-yl) formate (PubChem CID 159455381) has the molecular formula C30H35NO8 and a molecular weight of 537.61 g/mol. Its IUPAC name is acetic acid;2,2-diethyl-6-isocyano-3H-chromen-4-one;(2,2-diethyl-4-oxo-3H-chromen-6-yl) formate.
| Compound Name | acetic acid;2,2-diethyl-6-isocyano-3H-chromen-4-one;(2,2-diethyl-4-oxo-3H-chromen-6-yl) formate |
|---|---|
| PubChem CID | 159455381 |
| Molecular Formula | C30H35NO8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | acetic acid;2,2-diethyl-6-isocyano-3H-chromen-4-one;(2,2-diethyl-4-oxo-3H-chromen-6-yl) formate |
| SMILES | CC(=O)O.CCC1(CC)CC(=O)c2cc(OC=O)ccc2O1.[C-]#[N+]c1ccc2c(c1)C(=O)CC(CC)(CC)O2 |
| InChI | InChI=1S/C14H15NO2.C14H16O4.C2H4O2/c1-4-14(5-2)9-12(16)11-8-10(15-3)6-7-13(11)17-14;1-3-14(4-2)8-12(16)11-7-10(17-9-15)5-6-13(11)18-14;1-2(3)4/h6-8H,4-5,9H2,1-2H3;5-7,9H,3-4,8H2,1-2H3;1H3,(H,3,4) |
| InChIKey | IIMJRQNKSSPBNM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|