C28H32N4O8 — CID 160853770
2,2-dimethyl-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one;(2,2-dimethyl-4-oxo-3H-chromen-6-yl) formate;N'-hydroxyethanimidamide (PubChem CID 160853770) has the molecular formula C28H32N4O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is 2,2-dimethyl-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one;(2,2-dimethyl-4-oxo-3H-chromen-6-yl) formate;N'-hydroxyethanimidamide.
| Compound Name | 2,2-dimethyl-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one;(2,2-dimethyl-4-oxo-3H-chromen-6-yl) formate;N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 160853770 |
| Molecular Formula | C28H32N4O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 2,2-dimethyl-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3H-chromen-4-one;(2,2-dimethyl-4-oxo-3H-chromen-6-yl) formate;N'-hydroxyethanimidamide |
| SMILES | CC(N)=NO.CC1(C)CC(=O)c2cc(OC=O)ccc2O1.Cc1noc(-c2ccc3c(c2)C(=O)CC(C)(C)O3)n1 |
| InChI | InChI=1S/C14H14N2O3.C12H12O4.C2H6N2O/c1-8-15-13(19-16-8)9-4-5-12-10(6-9)11(17)7-14(2,3)18-12;1-12(2)6-10(14)9-5-8(15-7-13)3-4-11(9)16-12;1-2(3)4-5/h4-6H,7H2,1-3H3;3-5,7H,6H2,1-2H3;5H,1H3,(H2,3,4) |
| InChIKey | SJPHDAREZJVVOX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|