C21H20N4O4 — CID 170935966
6-[3-(3-amino-4-nitrosophenyl)-1,2,4-oxadiazol-5-yl]-2,2-diethyl-3H-chromen-4-one (PubChem CID 170935966) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 6-[3-(3-amino-4-nitrosophenyl)-1,2,4-oxadiazol-5-yl]-2,2-diethyl-3H-chromen-4-one.
| Compound Name | 6-[3-(3-amino-4-nitrosophenyl)-1,2,4-oxadiazol-5-yl]-2,2-diethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 170935966 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 6-[3-(3-amino-4-nitrosophenyl)-1,2,4-oxadiazol-5-yl]-2,2-diethyl-3H-chromen-4-one |
| SMILES | CCC1(CC)CC(=O)c2cc(-c3nc(-c4ccc(N=O)c(N)c4)no3)ccc2O1 |
| InChI | InChI=1S/C21H20N4O4/c1-3-21(4-2)11-17(26)14-9-13(6-8-18(14)28-21)20-23-19(25-29-20)12-5-7-16(24-27)15(22)10-12/h5-10H,3-4,11,22H2,1-2H3 |
| InChIKey | OBYLRASQKKQNEN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|