About 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one
6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one (PubChem CID 168858191) has the molecular formula C26H26O3
and a molecular weight of 386.49 g/mol. Its IUPAC name is 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one.
Molecular Properties
| Compound Name | 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one |
| PubChem CID | 168858191 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one |
| SMILES | CCC1(CC)CC(=O)c2cc(C3=CC(c4ccc(C(C)=O)cc4)=CC3)ccc2O1 |
| InChI | InChI=1S/C26H26O3/c1-4-26(5-2)16-24(28)23-15-22(12-13-25(23)29-26)21-11-10-20(14-21)19-8-6-18(7-9-19)17(3)27/h6-10,12-15H,4-5,11,16H2,1-3H3 |
| InChIKey | HASZIUAHXUKMEI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one?
The IUPAC name of 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one (CID 168858191) is 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one.
What is the SMILES notation for 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one?
The canonical SMILES for 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one is CCC1(CC)CC(=O)c2cc(C3=CC(c4ccc(C(C)=O)cc4)=CC3)ccc2O1.
What is the InChIKey of 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one?
The InChIKey is HASZIUAHXUKMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26O3/c1-4-26(5-2)16-24(28)23-15-22(12-13-25(23)29-26)21-11-10-20(14-21)19-8-6-18(7-9-19)17(3)27/h6-10,12-15H,4-5,11,16H2,1-3H3.
What are the key properties of 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one?
6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one has a molecular weight of 386.49 g/mol, XLogP of 6.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4-acetylphenyl)cyclopenta-1,3-dien-1-yl]-2,2-diethyl-3H-chromen-4-one is sourced from PubChem (CID 168858191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).