C32H42BBrO6 — CID 162265916
6-bromo-2,2-diethyl-3H-chromen-4-one;2,2-diethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-chromen-4-one (PubChem CID 162265916) has the molecular formula C32H42BBrO6 and a molecular weight of 613.40 g/mol. Its IUPAC name is 6-bromo-2,2-diethyl-3H-chromen-4-one;2,2-diethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-chromen-4-one.
| Compound Name | 6-bromo-2,2-diethyl-3H-chromen-4-one;2,2-diethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 162265916 |
| Molecular Formula | C32H42BBrO6 |
| Molecular Weight | 613.40 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 6-bromo-2,2-diethyl-3H-chromen-4-one;2,2-diethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-chromen-4-one |
| SMILES | CCC1(CC)CC(=O)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2O1.CCC1(CC)CC(=O)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C19H27BO4.C13H15BrO2/c1-7-19(8-2)12-15(21)14-11-13(9-10-16(14)22-19)20-23-17(3,4)18(5,6)24-20;1-3-13(4-2)8-11(15)10-7-9(14)5-6-12(10)16-13/h9-11H,7-8,12H2,1-6H3;5-7H,3-4,8H2,1-2H3 |
| InChIKey | ZZWYFRYOGLQSEN-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.40 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|