C28H28F3N7O4 — CID 159455395
N-[6-[4-[4-(4-hydroxybutanoyl)triazol-1-yl]butyl]pyridazin-3-yl]-2-[4-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]acetamide (PubChem CID 159455395) has the molecular formula C28H28F3N7O4 and a molecular weight of 583.57 g/mol. Its IUPAC name is N-[6-[4-[4-(4-hydroxybutanoyl)triazol-1-yl]butyl]pyridazin-3-yl]-2-[4-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]acetamide.
| Compound Name | N-[6-[4-[4-(4-hydroxybutanoyl)triazol-1-yl]butyl]pyridazin-3-yl]-2-[4-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 159455395 |
| Molecular Formula | C28H28F3N7O4 |
| Molecular Weight | 583.57 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | N-[6-[4-[4-(4-hydroxybutanoyl)triazol-1-yl]butyl]pyridazin-3-yl]-2-[4-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]acetamide |
| SMILES | O=C(Cc1cc(-c2cccc(OC(F)(F)F)c2)ccn1)Nc1ccc(CCCCn2cc(C(=O)CCCO)nn2)nn1 |
| InChI | InChI=1S/C28H28F3N7O4/c29-28(30,31)42-23-7-3-5-19(16-23)20-11-12-32-22(15-20)17-27(41)33-26-10-9-21(34-36-26)6-1-2-13-38-18-24(35-37-38)25(40)8-4-14-39/h3,5,7,9-12,15-16,18,39H,1-2,4,6,8,13-14,17H2,(H,33,36,41) |
| InChIKey | PVQFWWYIVCWLDW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|