C18H33FN2O2 — CID 159458731
4-fluoro-4-methyl-1-(oxetan-3-yl)piperidine;4-methyl-1-(oxetan-3-yl)piperidine (PubChem CID 159458731) has the molecular formula C18H33FN2O2 and a molecular weight of 328.47 g/mol. Its IUPAC name is 4-fluoro-4-methyl-1-(oxetan-3-yl)piperidine;4-methyl-1-(oxetan-3-yl)piperidine.
| Compound Name | 4-fluoro-4-methyl-1-(oxetan-3-yl)piperidine;4-methyl-1-(oxetan-3-yl)piperidine |
|---|---|
| PubChem CID | 159458731 |
| Molecular Formula | C18H33FN2O2 |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 4-fluoro-4-methyl-1-(oxetan-3-yl)piperidine;4-methyl-1-(oxetan-3-yl)piperidine |
| SMILES | CC1(F)CCN(C2COC2)CC1.CC1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C9H16FNO.C9H17NO/c1-9(10)2-4-11(5-3-9)8-6-12-7-8;1-8-2-4-10(5-3-8)9-6-11-7-9/h8H,2-7H2,1H3;8-9H,2-7H2,1H3 |
| InChIKey | LUHVUQSYMQKJDX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |