C15H24O9 — CID 159459796
2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-(2-methoxyethoxy)-3-oxobutanoate (PubChem CID 159459796) has the molecular formula C15H24O9 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-(2-methoxyethoxy)-3-oxobutanoate.
| Compound Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-(2-methoxyethoxy)-3-oxobutanoate |
|---|---|
| PubChem CID | 159459796 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-(2-methoxyethoxy)-3-oxobutanoate |
| SMILES | CC1(C)OC(=O)CC(=O)O1.CCOC(=O)CC(=O)COCCOC |
| InChI | InChI=1S/C9H16O5.C6H8O4/c1-3-14-9(11)6-8(10)7-13-5-4-12-2;1-6(2)9-4(7)3-5(8)10-6/h3-7H2,1-2H3;3H2,1-2H3 |
| InChIKey | LULGGPHIGUVMAD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|