C24H15FN2O — CID 15946501
[2-(4-fluorophenyl)phenyl]-(9H-pyrido[3,4-b]indol-1-yl)methanone (PubChem CID 15946501) has the molecular formula C24H15FN2O and a molecular weight of 366.40 g/mol. Its IUPAC name is [2-(4-fluorophenyl)phenyl]-(9H-pyrido[3,4-b]indol-1-yl)methanone.
| Compound Name | [2-(4-fluorophenyl)phenyl]-(9H-pyrido[3,4-b]indol-1-yl)methanone |
|---|---|
| PubChem CID | 15946501 |
| Molecular Formula | C24H15FN2O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-(4-fluorophenyl)phenyl]-(9H-pyrido[3,4-b]indol-1-yl)methanone |
| SMILES | O=C(c1ccccc1-c1ccc(F)cc1)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C24H15FN2O/c25-16-11-9-15(10-12-16)17-5-1-2-7-20(17)24(28)23-22-19(13-14-26-23)18-6-3-4-8-21(18)27-22/h1-14,27H |
| InChIKey | MMXBEJAJURJOBR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |