C10H12ClF7 — CID 159466515
chlorocyclopentane;1,1,2,2,3,3,4-heptafluorocyclopentane (PubChem CID 159466515) has the molecular formula C10H12ClF7 and a molecular weight of 300.65 g/mol. Its IUPAC name is chlorocyclopentane;1,1,2,2,3,3,4-heptafluorocyclopentane.
| Compound Name | chlorocyclopentane;1,1,2,2,3,3,4-heptafluorocyclopentane |
|---|---|
| PubChem CID | 159466515 |
| Molecular Formula | C10H12ClF7 |
| Molecular Weight | 300.65 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | chlorocyclopentane;1,1,2,2,3,3,4-heptafluorocyclopentane |
| SMILES | ClC1CCCC1.FC1CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5H9Cl.C5H3F7/c6-5-3-1-2-4-5;6-2-1-3(7,8)5(11,12)4(2,9)10/h5H,1-4H2;2H,1H2 |
| InChIKey | LVGGTKGLBOBDFJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|