C18H24NO3S2 — CID 15946820
CID 15946820 (PubChem CID 15946820) has the molecular formula C18H24NO3S2 and a molecular weight of 366.53 g/mol.
| Compound Name | CID 15946820 |
|---|---|
| PubChem CID | 15946820 |
| Molecular Formula | C18H24NO3S2 |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)[C]2[CH][CH][CH][C]2[S@@](=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H24NO3S2/c1-13-9-11-15(12-10-13)24(21,22)19-14(2)16-7-6-8-17(16)23(20)18(3,4)5/h6-12,14,19H,1-5H3/t14-,23+/m0/s1 |
| InChIKey | YLYWTWSVPSMQFZ-LFVRLGFBSA-N |
| XLogP | 2.94 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |