C20H28NO3S2 — CID 15946824
CID 15946824 (PubChem CID 15946824) has the molecular formula C20H28NO3S2 and a molecular weight of 394.58 g/mol.
| Compound Name | CID 15946824 |
|---|---|
| PubChem CID | 15946824 |
| Molecular Formula | C20H28NO3S2 |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]([C]2[CH][CH][CH][C]2[S@@](=O)C(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C20H28NO3S2/c1-14(2)19(17-8-7-9-18(17)25(22)20(4,5)6)21-26(23,24)16-12-10-15(3)11-13-16/h7-14,19,21H,1-6H3/t19-,25-/m1/s1 |
| InChIKey | SXBVFPOOCGZPDE-KBMIEXCESA-N |
| XLogP | 3.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |