C27H28O5S — CID 15946987
(1R,2S,4S,5R)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfinyl-3,6-dioxabicyclo[3.1.0]hexane (PubChem CID 15946987) has the molecular formula C27H28O5S and a molecular weight of 464.58 g/mol. Its IUPAC name is (1R,2S,4S,5R)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfinyl-3,6-dioxabicyclo[3.1.0]hexane.
| Compound Name | (1R,2S,4S,5R)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfinyl-3,6-dioxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 15946987 |
| Molecular Formula | C27H28O5S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (1R,2S,4S,5R)-2-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-(4-methylphenyl)sulfinyl-3,6-dioxabicyclo[3.1.0]hexane |
| SMILES | Cc1ccc(S(=O)[C@@H]2O[C@@H]([C@@H](COCc3ccccc3)OCc3ccccc3)[C@H]3O[C@H]32)cc1 |
| InChI | InChI=1S/C27H28O5S/c1-19-12-14-22(15-13-19)33(28)27-26-25(31-26)24(32-27)23(30-17-21-10-6-3-7-11-21)18-29-16-20-8-4-2-5-9-20/h2-15,23-27H,16-18H2,1H3/t23-,24+,25-,26-,27+,33?/m1/s1 |
| InChIKey | PEPLEZHERSIEFQ-BTZSJJNBSA-N |
| XLogP | 4.40 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|