C13H24N2O3 — CID 159474766
N-ethyl-2-methylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide (PubChem CID 159474766) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-ethyl-2-methylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide.
| Compound Name | N-ethyl-2-methylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 159474766 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-ethyl-2-methylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC.C=C(C)C(=O)NCCCO |
| InChI | InChI=1S/C7H13NO2.C6H11NO/c1-6(2)7(10)8-4-3-5-9;1-4-7-6(8)5(2)3/h9H,1,3-5H2,2H3,(H,8,10);2,4H2,1,3H3,(H,7,8) |
| InChIKey | LWFYBXIMBWKWRC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|