C22H46N2O — CID 159485206
4-tert-butyl-1-(oxetan-3-yl)piperidine;1-tert-butylpiperidine;methane (PubChem CID 159485206) has the molecular formula C22H46N2O and a molecular weight of 354.62 g/mol. Its IUPAC name is 4-tert-butyl-1-(oxetan-3-yl)piperidine;1-tert-butylpiperidine;methane.
| Compound Name | 4-tert-butyl-1-(oxetan-3-yl)piperidine;1-tert-butylpiperidine;methane |
|---|---|
| PubChem CID | 159485206 |
| Molecular Formula | C22H46N2O |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.36 |
| IUPAC Name | 4-tert-butyl-1-(oxetan-3-yl)piperidine;1-tert-butylpiperidine;methane |
| SMILES | C.CC(C)(C)C1CCN(C2COC2)CC1.CC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C12H23NO.C9H19N.CH4/c1-12(2,3)10-4-6-13(7-5-10)11-8-14-9-11;1-9(2,3)10-7-5-4-6-8-10;/h10-11H,4-9H2,1-3H3;4-8H2,1-3H3;1H4 |
| InChIKey | LXMLJHPAZGPVQL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |