About CID 159486235
CID 159486235 (PubChem CID 159486235) has the molecular formula C6H7B2O4
and a molecular weight of 164.74 g/mol.
Molecular Properties
| Compound Name | CID 159486235 |
| PubChem CID | 159486235 |
| Molecular Formula | C6H7B2O4 |
| Molecular Weight | 164.74 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | — |
| SMILES | O[B]OB(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C6H7B2O4/c9-6-3-1-5(2-4-6)8(11)12-7-10/h1-4,9-11H |
| InChIKey | MXSSIVHFYZLOLU-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.74 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159486235 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159486235?
The IUPAC name of CID 159486235 (CID 159486235) is not available.
What is the SMILES notation for CID 159486235?
The canonical SMILES for CID 159486235 is O[B]OB(O)c1ccc(O)cc1.
What is the InChIKey of CID 159486235?
The InChIKey is MXSSIVHFYZLOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7B2O4/c9-6-3-1-5(2-4-6)8(11)12-7-10/h1-4,9-11H.
What are the key properties of CID 159486235?
CID 159486235 has a molecular weight of 164.74 g/mol, XLogP of -1.38, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159486235 is sourced from PubChem (CID 159486235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).