C32H32Br2N2O2 — CID 159490672
1-(4-anilino-2,6-dimethylphenyl)ethanone;2-bromo-1-[4-(4-bromoanilino)-2,6-dimethylphenyl]ethanone (PubChem CID 159490672) has the molecular formula C32H32Br2N2O2 and a molecular weight of 636.43 g/mol. Its IUPAC name is 1-(4-anilino-2,6-dimethylphenyl)ethanone;2-bromo-1-[4-(4-bromoanilino)-2,6-dimethylphenyl]ethanone.
| Compound Name | 1-(4-anilino-2,6-dimethylphenyl)ethanone;2-bromo-1-[4-(4-bromoanilino)-2,6-dimethylphenyl]ethanone |
|---|---|
| PubChem CID | 159490672 |
| Molecular Formula | C32H32Br2N2O2 |
| Molecular Weight | 636.43 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | 1-(4-anilino-2,6-dimethylphenyl)ethanone;2-bromo-1-[4-(4-bromoanilino)-2,6-dimethylphenyl]ethanone |
| SMILES | CC(=O)c1c(C)cc(Nc2ccccc2)cc1C.Cc1cc(Nc2ccc(Br)cc2)cc(C)c1C(=O)CBr |
| InChI | InChI=1S/C16H15Br2NO.C16H17NO/c1-10-7-14(8-11(2)16(10)15(20)9-17)19-13-5-3-12(18)4-6-13;1-11-9-15(10-12(2)16(11)13(3)18)17-14-7-5-4-6-8-14/h3-8,19H,9H2,1-2H3;4-10,17H,1-3H3 |
| InChIKey | LYDNHBINSZKXIM-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.43 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|