C30H33N5O4 — CID 159496704
4-(4-benzhydrylpiperazin-1-yl)-3-nitro-1-(4-oxopentyl)-4a,5-dihydro-1,5-naphthyridin-2-one (PubChem CID 159496704) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)-3-nitro-1-(4-oxopentyl)-4a,5-dihydro-1,5-naphthyridin-2-one.
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)-3-nitro-1-(4-oxopentyl)-4a,5-dihydro-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 159496704 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)-3-nitro-1-(4-oxopentyl)-4a,5-dihydro-1,5-naphthyridin-2-one |
| SMILES | CC(=O)CCCN1C(=O)C([N+](=O)[O-])=C(N2CCN(C(c3ccccc3)c3ccccc3)CC2)C2NC=CC=C21 |
| InChI | InChI=1S/C30H33N5O4/c1-22(36)10-9-17-34-25-15-8-16-31-26(25)28(29(30(34)37)35(38)39)33-20-18-32(19-21-33)27(23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-8,11-16,26-27,31H,9-10,17-21H2,1H3 |
| InChIKey | LYWIRLXCSUYHQL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|