About 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium
3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium (PubChem CID 159503562) has the molecular formula C25H38N2O2
and a molecular weight of 398.59 g/mol. Its IUPAC name is 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium.
Molecular Properties
| Compound Name | 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium |
| PubChem CID | 159503562 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium |
| SMILES | C.CC[N+](CC)(CC)CC.O=C([O-])CCN1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C16H15NO2.C8H20N.CH4/c18-16(19)9-10-17-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)17;1-5-9(6-2,7-3)8-4;/h1-8H,9-11H2,(H,18,19);5-8H2,1-4H3;1H4/q;+1;/p-1 |
| InChIKey | LZRRVFJMUIEXPH-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium?
The IUPAC name of 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium (CID 159503562) is 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium.
What is the SMILES notation for 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium?
The canonical SMILES for 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium is C.CC[N+](CC)(CC)CC.O=C([O-])CCN1c2ccccc2Cc2ccccc21.
What is the InChIKey of 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium?
The InChIKey is LZRRVFJMUIEXPH-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H15NO2.C8H20N.CH4/c18-16(19)9-10-17-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)17;1-5-9(6-2,7-3)8-4;/h1-8H,9-11H2,(H,18,19);5-8H2,1-4H3;1H4/q;+1;/p-1.
What are the key properties of 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium?
3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium has a molecular weight of 398.59 g/mol, XLogP of 4.39, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9H-acridin-10-yl)propanoate;methane;tetraethylazanium is sourced from PubChem (CID 159503562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).