C5H18O8Si3 — CID 159504865
[(dimethylsilyloxy-hydroxy-methylsilyl)oxy-hydroxy-methylsilyl]oxymethanetriol (PubChem CID 159504865) has the molecular formula C5H18O8Si3 and a molecular weight of 290.45 g/mol. Its IUPAC name is [(dimethylsilyloxy-hydroxy-methylsilyl)oxy-hydroxy-methylsilyl]oxymethanetriol.
| Compound Name | [(dimethylsilyloxy-hydroxy-methylsilyl)oxy-hydroxy-methylsilyl]oxymethanetriol |
|---|---|
| PubChem CID | 159504865 |
| Molecular Formula | C5H18O8Si3 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | [(dimethylsilyloxy-hydroxy-methylsilyl)oxy-hydroxy-methylsilyl]oxymethanetriol |
| SMILES | C[SiH](C)O[Si](C)(O)O[Si](C)(O)OC(O)(O)O |
| InChI | InChI=1S/C5H18O8Si3/c1-14(2)12-16(4,10)13-15(3,9)11-5(6,7)8/h6-10,14H,1-4H3 |
| InChIKey | YOPONVNLJPMBEL-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|