C22H23NO2S3 — CID 159517502
1-[3-(5-ethylthiophen-2-yl)sulfanylphenyl]sulfonyl-2-phenylpyrrolidine (PubChem CID 159517502) has the molecular formula C22H23NO2S3 and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-[3-(5-ethylthiophen-2-yl)sulfanylphenyl]sulfonyl-2-phenylpyrrolidine.
| Compound Name | 1-[3-(5-ethylthiophen-2-yl)sulfanylphenyl]sulfonyl-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 159517502 |
| Molecular Formula | C22H23NO2S3 |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 1-[3-(5-ethylthiophen-2-yl)sulfanylphenyl]sulfonyl-2-phenylpyrrolidine |
| SMILES | CCc1ccc(Sc2cccc(S(=O)(=O)N3CCCC3c3ccccc3)c2)s1 |
| InChI | InChI=1S/C22H23NO2S3/c1-2-18-13-14-22(26-18)27-19-10-6-11-20(16-19)28(24,25)23-15-7-12-21(23)17-8-4-3-5-9-17/h3-6,8-11,13-14,16,21H,2,7,12,15H2,1H3 |
| InChIKey | BAHIMQKYQMKUAP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |