C12H12F2O2 — CID 15953498
(1S,9R,10R,11S)-5,6-difluorotricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-10,11-diol (PubChem CID 15953498) has the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. Its IUPAC name is (1S,9R,10R,11S)-5,6-difluorotricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-10,11-diol.
| Compound Name | (1S,9R,10R,11S)-5,6-difluorotricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-10,11-diol |
|---|---|
| PubChem CID | 15953498 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1S,9R,10R,11S)-5,6-difluorotricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-10,11-diol |
| SMILES | O[C@@H]1[C@H]2Cc3c(ccc(F)c3F)[C@H](C2)[C@@H]1O |
| InChI | InChI=1S/C12H12F2O2/c13-9-2-1-6-7(10(9)14)3-5-4-8(6)12(16)11(5)15/h1-2,5,8,11-12,15-16H,3-4H2/t5-,8-,11+,12-/m0/s1 |
| InChIKey | ZZKAHJDRQCXUSI-MVFSZRQGSA-N |
| XLogP | 1.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |