C20H23F3N2O5 — CID 159535401
(1S)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-[4-(trifluoromethoxy)phenyl]piperazine (PubChem CID 159535401) has the molecular formula C20H23F3N2O5 and a molecular weight of 428.41 g/mol. Its IUPAC name is (1S)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-[4-(trifluoromethoxy)phenyl]piperazine.
| Compound Name | (1S)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-[4-(trifluoromethoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 159535401 |
| Molecular Formula | C20H23F3N2O5 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (1S)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-[4-(trifluoromethoxy)phenyl]piperazine |
| SMILES | C[C@@]1(C(=O)O)C=CC=C(C(=O)O)C1.FC(F)(F)Oc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C11H13F3N2O.C9H10O4/c12-11(13,14)17-10-3-1-9(2-4-10)16-7-5-15-6-8-16;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h1-4,15H,5-8H2;2-4H,5H2,1H3,(H,10,11)(H,12,13)/t;9-/m.1/s1 |
| InChIKey | MDNFFRIRTHTLHI-YYVQYPFISA-N |
| XLogP | 3.04 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|