C43H49BN8O2 — CID 159541404
[4-[(3-cyanophenyl)methyl-(1H-indol-5-yl)amino]piperidin-1-yl]-methylborinic acid;3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]benzamide (PubChem CID 159541404) has the molecular formula C43H49BN8O2 and a molecular weight of 720.73 g/mol. Its IUPAC name is [4-[(3-cyanophenyl)methyl-(1H-indol-5-yl)amino]piperidin-1-yl]-methylborinic acid;3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]benzamide.
| Compound Name | [4-[(3-cyanophenyl)methyl-(1H-indol-5-yl)amino]piperidin-1-yl]-methylborinic acid;3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 159541404 |
| Molecular Formula | C43H49BN8O2 |
| Molecular Weight | 720.73 g/mol |
| Exact Mass | 720.41 |
| IUPAC Name | [4-[(3-cyanophenyl)methyl-(1H-indol-5-yl)amino]piperidin-1-yl]-methylborinic acid;3-[[1H-indol-5-yl(piperidin-4-yl)amino]methyl]benzamide |
| SMILES | CB(O)N1CCC(N(Cc2cccc(C#N)c2)c2ccc3[nH]ccc3c2)CC1.NC(=O)c1cccc(CN(c2ccc3[nH]ccc3c2)C2CCNCC2)c1 |
| InChI | InChI=1S/C22H25BN4O.C21H24N4O/c1-23(28)26-11-8-20(9-12-26)27(16-18-4-2-3-17(13-18)15-24)21-5-6-22-19(14-21)7-10-25-22;22-21(26)17-3-1-2-15(12-17)14-25(18-7-9-23-10-8-18)19-4-5-20-16(13-19)6-11-24-20/h2-7,10,13-14,20,25,28H,8-9,11-12,16H2,1H3;1-6,11-13,18,23-24H,7-10,14H2,(H2,22,26) |
| InChIKey | MEGJYAHXNWDNCG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.73 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|