About sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide
sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide (PubChem CID 159542158) has the molecular formula C18H14N3NaO3S
and a molecular weight of 375.39 g/mol. Its IUPAC name is sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide.
Molecular Properties
| Compound Name | sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide |
| PubChem CID | 159542158 |
| Molecular Formula | C18H14N3NaO3S |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide |
| SMILES | O=S(=O)=O.[Na+].[c-]1cccc(/N=N/c2ccc(Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C18H14N3.Na.O3S/c1-3-7-15(8-4-1)19-16-11-13-18(14-12-16)21-20-17-9-5-2-6-10-17;;1-4(2)3/h1-5,7-14,19H;;/q-1;+1;/b21-20+;; |
| InChIKey | UZHUTVNMFIXNOD-SERMZQFOSA-N |
| XLogP | 1.65 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide?
The IUPAC name of sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide (CID 159542158) is sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide.
What is the SMILES notation for sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide?
The canonical SMILES for sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide is O=S(=O)=O.[Na+].[c-]1cccc(/N=N/c2ccc(Nc3ccccc3)cc2)c1.
What is the InChIKey of sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide?
The InChIKey is UZHUTVNMFIXNOD-SERMZQFOSA-N. The full InChI is InChI=1S/C18H14N3.Na.O3S/c1-3-7-15(8-4-1)19-16-11-13-18(14-12-16)21-20-17-9-5-2-6-10-17;;1-4(2)3/h1-5,7-14,19H;;/q-1;+1;/b21-20+;;.
What are the key properties of sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide?
sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide has a molecular weight of 375.39 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;N-phenyl-4-(phenyldiazenyl)aniline;sulfur trioxide is sourced from PubChem (CID 159542158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).