C21H41F3O — CID 159544609
4,4-dimethyloxane;1,1,1-trifluoro-4-methyltridecane (PubChem CID 159544609) has the molecular formula C21H41F3O and a molecular weight of 366.55 g/mol. Its IUPAC name is 4,4-dimethyloxane;1,1,1-trifluoro-4-methyltridecane.
| Compound Name | 4,4-dimethyloxane;1,1,1-trifluoro-4-methyltridecane |
|---|---|
| PubChem CID | 159544609 |
| Molecular Formula | C21H41F3O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 4,4-dimethyloxane;1,1,1-trifluoro-4-methyltridecane |
| SMILES | CC1(C)CCOCC1.CCCCCCCCCC(C)CCC(F)(F)F |
| InChI | InChI=1S/C14H27F3.C7H14O/c1-3-4-5-6-7-8-9-10-13(2)11-12-14(15,16)17;1-7(2)3-5-8-6-4-7/h13H,3-12H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | MEQJDIYLRCSSSZ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|