C22H28ClNO — CID 159545866
1,2-diphenyl-3-(piperidin-1-ylmethyl)but-3-en-2-ol;hydrochloride (PubChem CID 159545866) has the molecular formula C22H28ClNO and a molecular weight of 357.93 g/mol. Its IUPAC name is 1,2-diphenyl-3-(piperidin-1-ylmethyl)but-3-en-2-ol;hydrochloride.
| Compound Name | 1,2-diphenyl-3-(piperidin-1-ylmethyl)but-3-en-2-ol;hydrochloride |
|---|---|
| PubChem CID | 159545866 |
| Molecular Formula | C22H28ClNO |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1,2-diphenyl-3-(piperidin-1-ylmethyl)but-3-en-2-ol;hydrochloride |
| SMILES | C=C(CN1CCCCC1)C(O)(Cc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H27NO.ClH/c1-19(18-23-15-9-4-10-16-23)22(24,21-13-7-3-8-14-21)17-20-11-5-2-6-12-20;/h2-3,5-8,11-14,24H,1,4,9-10,15-18H2;1H |
| InChIKey | MEUFKDJSKZVDDR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|