C11H17Cl2NO2Si — CID 159549768
(1R)-2-amino-1-(3,4-dichlorophenoxy)-1-trimethylsilylethanol (PubChem CID 159549768) has the molecular formula C11H17Cl2NO2Si and a molecular weight of 294.25 g/mol. Its IUPAC name is (1R)-2-amino-1-(3,4-dichlorophenoxy)-1-trimethylsilylethanol.
| Compound Name | (1R)-2-amino-1-(3,4-dichlorophenoxy)-1-trimethylsilylethanol |
|---|---|
| PubChem CID | 159549768 |
| Molecular Formula | C11H17Cl2NO2Si |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (1R)-2-amino-1-(3,4-dichlorophenoxy)-1-trimethylsilylethanol |
| SMILES | C[Si](C)(C)[C@@](O)(CN)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H17Cl2NO2Si/c1-17(2,3)11(15,7-14)16-8-4-5-9(12)10(13)6-8/h4-6,15H,7,14H2,1-3H3/t11-/m1/s1 |
| InChIKey | MFFXFPJWPTTZKV-LLVKDONJSA-N |
| XLogP | 2.90 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|