C20H31N4O3S3+ — CID 159551092
3-[[2-[2-[2-[[(3R)-2-ethyl-3-hydroxybutanoyl]amino]ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]propyl-dimethylsulfanium (PubChem CID 159551092) has the molecular formula C20H31N4O3S3+ and a molecular weight of 471.69 g/mol. Its IUPAC name is 3-[[2-[2-[2-[[(3R)-2-ethyl-3-hydroxybutanoyl]amino]ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]propyl-dimethylsulfanium.
| Compound Name | 3-[[2-[2-[2-[[(3R)-2-ethyl-3-hydroxybutanoyl]amino]ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]propyl-dimethylsulfanium |
|---|---|
| PubChem CID | 159551092 |
| Molecular Formula | C20H31N4O3S3+ |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-[[2-[2-[2-[[(3R)-2-ethyl-3-hydroxybutanoyl]amino]ethyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonyl]amino]propyl-dimethylsulfanium |
| SMILES | CCC(C(=O)NCCc1nc(-c2nc(C(=O)NCCC[S+](C)C)cs2)cs1)[C@@H](C)O |
| InChI | InChI=1S/C20H30N4O3S3/c1-5-14(13(2)25)18(26)22-9-7-17-23-16(12-28-17)20-24-15(11-29-20)19(27)21-8-6-10-30(3)4/h11-14,25H,5-10H2,1-4H3,(H-,21,22,26,27)/p+1/t13-,14?/m1/s1 |
| InChIKey | LZCUNUBDZLCYGJ-KWCCSABGSA-O |
| XLogP | 2.33 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|