C21H37N7O2S2 — CID 156716364
2-[2-[2-(butanoylamino)ethyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazole-4-carboxamide;2-butylguanidine;ethane (PubChem CID 156716364) has the molecular formula C21H37N7O2S2 and a molecular weight of 483.71 g/mol. Its IUPAC name is 2-[2-[2-(butanoylamino)ethyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazole-4-carboxamide;2-butylguanidine;ethane.
| Compound Name | 2-[2-[2-(butanoylamino)ethyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazole-4-carboxamide;2-butylguanidine;ethane |
|---|---|
| PubChem CID | 156716364 |
| Molecular Formula | C21H37N7O2S2 |
| Molecular Weight | 483.71 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 2-[2-[2-(butanoylamino)ethyl]-1,3-thiazol-4-yl]-N-methyl-1,3-thiazole-4-carboxamide;2-butylguanidine;ethane |
| SMILES | CC.CCCC(=O)NCCc1nc(-c2nc(C(=O)NC)cs2)cs1.CCCCN=C(N)N |
| InChI | InChI=1S/C14H18N4O2S2.C5H13N3.C2H6/c1-3-4-11(19)16-6-5-12-17-10(8-21-12)14-18-9(7-22-14)13(20)15-2;1-2-3-4-8-5(6)7;1-2/h7-8H,3-6H2,1-2H3,(H,15,20)(H,16,19);2-4H2,1H3,(H4,6,7,8);1-2H3 |
| InChIKey | WGTLLWQZVXPXJQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|