C30H42N6O6S2 — CID 167710263
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamimidoyl]carbamate (PubChem CID 167710263) has the molecular formula C30H42N6O6S2 and a molecular weight of 646.84 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 167710263 |
| Molecular Formula | C30H42N6O6S2 |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[6-oxo-6-[2-[2-[2-(pent-4-ynoylamino)ethyl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexyl]carbamimidoyl]carbamate |
| SMILES | C#CCCC(=O)NCCc1nc(-c2nc(C(=O)CCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cs2)cs1 |
| InChI | InChI=1S/C30H42N6O6S2/c1-8-9-14-23(38)31-17-15-24-33-21(19-43-24)25-34-20(18-44-25)22(37)13-11-10-12-16-32-26(35-27(39)41-29(2,3)4)36-28(40)42-30(5,6)7/h1,18-19H,9-17H2,2-7H3,(H,31,38)(H2,32,35,36,39,40) |
| InChIKey | SSUOYYCNGOMKEH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|