C18H27ClN4O2S3 — CID 138402324
2-[2-(4-acetamidobutyl)-1,3-thiazol-4-yl]-N-(3-dimethylsulfoniopropyl)-1,3-thiazole-4-carboximidate;hydrochloride (PubChem CID 138402324) has the molecular formula C18H27ClN4O2S3 and a molecular weight of 463.09 g/mol. Its IUPAC name is 2-[2-(4-acetamidobutyl)-1,3-thiazol-4-yl]-N-(3-dimethylsulfoniopropyl)-1,3-thiazole-4-carboximidate;hydrochloride.
| Compound Name | 2-[2-(4-acetamidobutyl)-1,3-thiazol-4-yl]-N-(3-dimethylsulfoniopropyl)-1,3-thiazole-4-carboximidate;hydrochloride |
|---|---|
| PubChem CID | 138402324 |
| Molecular Formula | C18H27ClN4O2S3 |
| Molecular Weight | 463.09 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[2-(4-acetamidobutyl)-1,3-thiazol-4-yl]-N-(3-dimethylsulfoniopropyl)-1,3-thiazole-4-carboximidate;hydrochloride |
| SMILES | CC(=O)NCCCCc1nc(-c2nc(/C([O-])=N/CCC[S+](C)C)cs2)cs1.Cl |
| InChI | InChI=1S/C18H26N4O2S3.ClH/c1-13(23)19-8-5-4-7-16-21-15(12-25-16)18-22-14(11-26-18)17(24)20-9-6-10-27(2)3;/h11-12H,4-10H2,1-3H3,(H-,19,20,23,24);1H |
| InChIKey | QATMASLHCQEIDU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|