C18H20BBrN6O2 — CID 159555960
6-bromo-[1,2,4]triazolo[1,5-a]pyridine;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 159555960) has the molecular formula C18H20BBrN6O2 and a molecular weight of 443.11 g/mol. Its IUPAC name is 6-bromo-[1,2,4]triazolo[1,5-a]pyridine;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-bromo-[1,2,4]triazolo[1,5-a]pyridine;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 159555960 |
| Molecular Formula | C18H20BBrN6O2 |
| Molecular Weight | 443.11 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 6-bromo-[1,2,4]triazolo[1,5-a]pyridine;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Brc1ccc2ncnn2c1.CC1(C)OB(c2ccc3ncnn3c2)OC1(C)C |
| InChI | InChI=1S/C12H16BN3O2.C6H4BrN3/c1-11(2)12(3,4)18-13(17-11)9-5-6-10-14-8-15-16(10)7-9;7-5-1-2-6-8-4-9-10(6)3-5/h5-8H,1-4H3;1-4H |
| InChIKey | MFZLDPKHCZZCLR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|