C27H30N4OS — CID 15956197
N-(3-methylbutyl)-N-(4-morpholin-4-ylphenyl)-6-thiophen-2-ylquinazolin-4-amine (PubChem CID 15956197) has the molecular formula C27H30N4OS and a molecular weight of 458.63 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-(4-morpholin-4-ylphenyl)-6-thiophen-2-ylquinazolin-4-amine.
| Compound Name | N-(3-methylbutyl)-N-(4-morpholin-4-ylphenyl)-6-thiophen-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 15956197 |
| Molecular Formula | C27H30N4OS |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N-(3-methylbutyl)-N-(4-morpholin-4-ylphenyl)-6-thiophen-2-ylquinazolin-4-amine |
| SMILES | CC(C)CCN(c1ccc(N2CCOCC2)cc1)c1ncnc2ccc(-c3cccs3)cc12 |
| InChI | InChI=1S/C27H30N4OS/c1-20(2)11-12-31(23-8-6-22(7-9-23)30-13-15-32-16-14-30)27-24-18-21(26-4-3-17-33-26)5-10-25(24)28-19-29-27/h3-10,17-20H,11-16H2,1-2H3 |
| InChIKey | COBQDKKIDUYQKQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|