C44H51N3O4 — CID 11193268
2-[(E)-2-[4-[N-(3-methylbutyl)anilino]phenyl]ethenyl]-5-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]benzonitrile (PubChem CID 11193268) has the molecular formula C44H51N3O4 and a molecular weight of 685.91 g/mol. Its IUPAC name is 2-[(E)-2-[4-[N-(3-methylbutyl)anilino]phenyl]ethenyl]-5-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]benzonitrile.
| Compound Name | 2-[(E)-2-[4-[N-(3-methylbutyl)anilino]phenyl]ethenyl]-5-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 11193268 |
| Molecular Formula | C44H51N3O4 |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.39 |
| IUPAC Name | 2-[(E)-2-[4-[N-(3-methylbutyl)anilino]phenyl]ethenyl]-5-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]benzonitrile |
| SMILES | CC(C)CCN(c1ccccc1)c1ccc(/C=C/c2ccc(/C=C/c3ccc(N4CCOCCOCCOCCOCC4)cc3)cc2C#N)cc1 |
| InChI | InChI=1S/C44H51N3O4/c1-36(2)22-23-47(43-6-4-3-5-7-43)44-20-14-38(15-21-44)10-16-40-17-11-39(34-41(40)35-45)9-8-37-12-18-42(19-13-37)46-24-26-48-28-30-50-32-33-51-31-29-49-27-25-46/h3-21,34,36H,22-33H2,1-2H3/b9-8+,16-10+ |
| InChIKey | ZHORQODPUKSLPD-OFZPYADDSA-N |
| XLogP | 8.97 |
| TPSA | 67.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|