C57H62Br4N4 — CID 159562758
2,4-bis(4-tert-butylphenyl)-6-(3,5-dibromo-4-methylphenyl)-1,3,5-triazine;3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline (PubChem CID 159562758) has the molecular formula C57H62Br4N4 and a molecular weight of 1122.77 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-(3,5-dibromo-4-methylphenyl)-1,3,5-triazine;3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-(3,5-dibromo-4-methylphenyl)-1,3,5-triazine;3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline |
|---|---|
| PubChem CID | 159562758 |
| Molecular Formula | C57H62Br4N4 |
| Molecular Weight | 1122.77 g/mol |
| Exact Mass | 1118.17 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-(3,5-dibromo-4-methylphenyl)-1,3,5-triazine;3,5-dibromo-N,N-bis(4-tert-butylphenyl)-4-methylaniline |
| SMILES | Cc1c(Br)cc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1Br.Cc1c(Br)cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1Br |
| InChI | InChI=1S/C30H31Br2N3.C27H31Br2N/c1-18-24(31)16-21(17-25(18)32)28-34-26(19-8-12-22(13-9-19)29(2,3)4)33-27(35-28)20-10-14-23(15-11-20)30(5,6)7;1-18-24(28)16-23(17-25(18)29)30(21-12-8-19(9-13-21)26(2,3)4)22-14-10-20(11-15-22)27(5,6)7/h8-17H,1-7H3;8-17H,1-7H3 |
| InChIKey | MGVDADNOCYYPGL-UHFFFAOYSA-N |
| XLogP | 18.89 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1122.77 |
| LogP ≤ 5 | 18.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |