C37H32N4 — CID 23527961
4-[4-(4-butan-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylaniline (PubChem CID 23527961) has the molecular formula C37H32N4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 4-[4-(4-butan-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[4-(4-butan-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 23527961 |
| Molecular Formula | C37H32N4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 4-[4-(4-butan-2-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
| SMILES | CCC(C)c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C37H32N4/c1-3-27(2)28-19-21-30(22-20-28)36-38-35(29-13-7-4-8-14-29)39-37(40-36)31-23-25-34(26-24-31)41(32-15-9-5-10-16-32)33-17-11-6-12-18-33/h4-27H,3H2,1-2H3 |
| InChIKey | QNXLHFRVVNYCAS-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |