C41H39BrIN5 — CID 23557769
4-N-(4-bromophenyl)-2-N,4-N-bis(4-butan-2-ylphenyl)-2-N-(4-iodophenyl)-6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 23557769) has the molecular formula C41H39BrIN5 and a molecular weight of 808.61 g/mol. Its IUPAC name is 4-N-(4-bromophenyl)-2-N,4-N-bis(4-butan-2-ylphenyl)-2-N-(4-iodophenyl)-6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(4-bromophenyl)-2-N,4-N-bis(4-butan-2-ylphenyl)-2-N-(4-iodophenyl)-6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23557769 |
| Molecular Formula | C41H39BrIN5 |
| Molecular Weight | 808.61 g/mol |
| Exact Mass | 807.14 |
| IUPAC Name | 4-N-(4-bromophenyl)-2-N,4-N-bis(4-butan-2-ylphenyl)-2-N-(4-iodophenyl)-6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(C)c1ccc(N(c2ccc(Br)cc2)c2nc(-c3ccccc3)nc(N(c3ccc(I)cc3)c3ccc(C(C)CC)cc3)n2)cc1 |
| InChI | InChI=1S/C41H39BrIN5/c1-5-28(3)30-12-20-35(21-13-30)47(37-24-16-33(42)17-25-37)40-44-39(32-10-8-7-9-11-32)45-41(46-40)48(38-26-18-34(43)19-27-38)36-22-14-31(15-23-36)29(4)6-2/h7-29H,5-6H2,1-4H3 |
| InChIKey | CFZAPYMEHQTLKV-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.61 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|