C39H36N4 — CID 23527762
4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline (PubChem CID 23527762) has the molecular formula C39H36N4 and a molecular weight of 560.75 g/mol. Its IUPAC name is 4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 23527762 |
| Molecular Formula | C39H36N4 |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 4-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
| SMILES | Cc1cc(C)c(-c2nc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)nc(-c3c(C)cc(C)cc3C)n2)c(C)c1 |
| InChI | InChI=1S/C39H36N4/c1-25-21-27(3)35(28(4)22-25)38-40-37(41-39(42-38)36-29(5)23-26(2)24-30(36)6)31-17-19-34(20-18-31)43(32-13-9-7-10-14-32)33-15-11-8-12-16-33/h7-24H,1-6H3 |
| InChIKey | CMMAZSILNHBLCF-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |