C33H36N4 — CID 23527765
4-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline (PubChem CID 23527765) has the molecular formula C33H36N4 and a molecular weight of 488.68 g/mol. Its IUPAC name is 4-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline.
| Compound Name | 4-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 23527765 |
| Molecular Formula | C33H36N4 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 4-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline |
| SMILES | c1ccc(N(c2ccccc2)c2ccc(-c3nc(C4CCCCC4)nc(C4CCCCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C33H36N4/c1-5-13-25(14-6-1)31-34-32(26-15-7-2-8-16-26)36-33(35-31)27-21-23-30(24-22-27)37(28-17-9-3-10-18-28)29-19-11-4-12-20-29/h3-4,9-12,17-26H,1-2,5-8,13-16H2 |
| InChIKey | QEOMDUXWVLMVAJ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |