C37H32N4 — CID 23527924
3-butan-2-yl-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline (PubChem CID 23527924) has the molecular formula C37H32N4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 3-butan-2-yl-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline.
| Compound Name | 3-butan-2-yl-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 23527924 |
| Molecular Formula | C37H32N4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 3-butan-2-yl-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline |
| SMILES | CCC(C)c1cccc(N(c2ccccc2)c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c1 |
| InChI | InChI=1S/C37H32N4/c1-3-27(2)31-18-13-21-34(26-31)41(32-19-11-6-12-20-32)33-24-22-30(23-25-33)37-39-35(28-14-7-4-8-15-28)38-36(40-37)29-16-9-5-10-17-29/h4-27H,3H2,1-2H3 |
| InChIKey | KYRLXFOPSQALDQ-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |