About N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane
N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane (PubChem CID 159563404) has the molecular formula C12H25N2+
and a molecular weight of 197.35 g/mol. Its IUPAC name is N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane.
Molecular Properties
| Compound Name | N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane |
| PubChem CID | 159563404 |
| Molecular Formula | C12H25N2+ |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.20 |
| IUPAC Name | N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane |
| SMILES | C.C.C[n+]1ccc(NC(C)(C)C)cc1 |
| InChI | InChI=1S/C10H16N2.2CH4/c1-10(2,3)11-9-5-7-12(4)8-6-9;;/h5-8H,1-4H3;2*1H4/p+1 |
| InChIKey | RAVDBKODWXSANM-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane?
The IUPAC name of N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane (CID 159563404) is N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane.
What is the SMILES notation for N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane?
The canonical SMILES for N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane is C.C.C[n+]1ccc(NC(C)(C)C)cc1.
What is the InChIKey of N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane?
The InChIKey is RAVDBKODWXSANM-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H16N2.2CH4/c1-10(2,3)11-9-5-7-12(4)8-6-9;;/h5-8H,1-4H3;2*1H4/p+1.
What are the key properties of N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane?
N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane has a molecular weight of 197.35 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-methylpyridin-1-ium-4-amine;methane is sourced from PubChem (CID 159563404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).